C21H34O3 — CID 54302313
(6S,8E,10E,12Z,14E)-6,7-dihydroxyhenicosa-8,10,12,14-tetraen-2-one (PubChem CID 54302313) has the molecular formula C21H34O3 and a molecular weight of 334.50 g/mol. Its IUPAC name is (6S,8E,10E,12Z,14E)-6,7-dihydroxyhenicosa-8,10,12,14-tetraen-2-one.
| Compound Name | (6S,8E,10E,12Z,14E)-6,7-dihydroxyhenicosa-8,10,12,14-tetraen-2-one |
|---|---|
| PubChem CID | 54302313 |
| Molecular Formula | C21H34O3 |
| Molecular Weight | 334.50 g/mol |
| Exact Mass | 334.25 |
| IUPAC Name | (6S,8E,10E,12Z,14E)-6,7-dihydroxyhenicosa-8,10,12,14-tetraen-2-one |
| SMILES | CCCCCC/C=C/C=C\C=C\C=C\C(O)[C@@H](O)CCCC(C)=O |
| InChI | InChI=1S/C21H34O3/c1-3-4-5-6-7-8-9-10-11-12-13-14-17-20(23)21(24)18-15-16-19(2)22/h8-14,17,20-21,23-24H,3-7,15-16,18H2,1-2H3/b9-8+,11-10-,13-12+,17-14+/t20?,21-/m0/s1 |
| InChIKey | SFCHMJLCDVVRDI-JABCSSBVSA-N |
| XLogP | 4.66 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.50 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|