C26H30N2O4 — CID 54302405
4-[[(5S)-9-benzyl-5-carbamoyl-2-ethyl-5,6,7,8-tetrahydrocarbazol-3-yl]oxy]butanoic acid (PubChem CID 54302405) has the molecular formula C26H30N2O4 and a molecular weight of 434.54 g/mol. Its IUPAC name is 4-[[(5S)-9-benzyl-5-carbamoyl-2-ethyl-5,6,7,8-tetrahydrocarbazol-3-yl]oxy]butanoic acid.
| Compound Name | 4-[[(5S)-9-benzyl-5-carbamoyl-2-ethyl-5,6,7,8-tetrahydrocarbazol-3-yl]oxy]butanoic acid |
|---|---|
| PubChem CID | 54302405 |
| Molecular Formula | C26H30N2O4 |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.22 |
| IUPAC Name | 4-[[(5S)-9-benzyl-5-carbamoyl-2-ethyl-5,6,7,8-tetrahydrocarbazol-3-yl]oxy]butanoic acid |
| SMILES | CCc1cc2c(cc1OCCCC(=O)O)c1c(n2Cc2ccccc2)CCC[C@@H]1C(N)=O |
| InChI | InChI=1S/C26H30N2O4/c1-2-18-14-22-20(15-23(18)32-13-7-12-24(29)30)25-19(26(27)31)10-6-11-21(25)28(22)16-17-8-4-3-5-9-17/h3-5,8-9,14-15,19H,2,6-7,10-13,16H2,1H3,(H2,27,31)(H,29,30)/t19-/m0/s1 |
| InChIKey | SFDXDSDKMGTHOJ-IBGZPJMESA-N |
| XLogP | 4.40 |
| TPSA | 94.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|