C28H34N2O4 — CID 54399135
ethyl 4-[[(5S)-9-benzyl-5-carbamoyl-2-ethyl-5,6,7,8-tetrahydrocarbazol-3-yl]oxy]butanoate (PubChem CID 54399135) has the molecular formula C28H34N2O4 and a molecular weight of 462.59 g/mol. Its IUPAC name is ethyl 4-[[(5S)-9-benzyl-5-carbamoyl-2-ethyl-5,6,7,8-tetrahydrocarbazol-3-yl]oxy]butanoate.
| Compound Name | ethyl 4-[[(5S)-9-benzyl-5-carbamoyl-2-ethyl-5,6,7,8-tetrahydrocarbazol-3-yl]oxy]butanoate |
|---|---|
| PubChem CID | 54399135 |
| Molecular Formula | C28H34N2O4 |
| Molecular Weight | 462.59 g/mol |
| Exact Mass | 462.25 |
| IUPAC Name | ethyl 4-[[(5S)-9-benzyl-5-carbamoyl-2-ethyl-5,6,7,8-tetrahydrocarbazol-3-yl]oxy]butanoate |
| SMILES | CCOC(=O)CCCOc1cc2c3c(n(Cc4ccccc4)c2cc1CC)CCC[C@@H]3C(N)=O |
| InChI | InChI=1S/C28H34N2O4/c1-3-20-16-24-22(17-25(20)34-15-9-14-26(31)33-4-2)27-21(28(29)32)12-8-13-23(27)30(24)18-19-10-6-5-7-11-19/h5-7,10-11,16-17,21H,3-4,8-9,12-15,18H2,1-2H3,(H2,29,32)/t21-/m0/s1 |
| InChIKey | VMDUREQZSKPGRA-NRFANRHFSA-N |
| XLogP | 4.88 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.59 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|