C32H54O9 — CID 54304394
methyl 5-acetyloxy-7-[(1R,2S,5S)-2-acetyloxy-5-(4,4-dimethyloctyl)cyclopentyl]-2-(oxan-2-yloxy)-3-oxoheptanoate (PubChem CID 54304394) has the molecular formula C32H54O9 and a molecular weight of 582.78 g/mol. Its IUPAC name is methyl 5-acetyloxy-7-[(1R,2S,5S)-2-acetyloxy-5-(4,4-dimethyloctyl)cyclopentyl]-2-(oxan-2-yloxy)-3-oxoheptanoate.
| Compound Name | methyl 5-acetyloxy-7-[(1R,2S,5S)-2-acetyloxy-5-(4,4-dimethyloctyl)cyclopentyl]-2-(oxan-2-yloxy)-3-oxoheptanoate |
|---|---|
| PubChem CID | 54304394 |
| Molecular Formula | C32H54O9 |
| Molecular Weight | 582.78 g/mol |
| Exact Mass | 582.38 |
| IUPAC Name | methyl 5-acetyloxy-7-[(1R,2S,5S)-2-acetyloxy-5-(4,4-dimethyloctyl)cyclopentyl]-2-(oxan-2-yloxy)-3-oxoheptanoate |
| SMILES | CCCCC(C)(C)CCC[C@H]1CC[C@H](OC(C)=O)[C@@H]1CCC(CC(=O)C(OC1CCCCO1)C(=O)OC)OC(C)=O |
| InChI | InChI=1S/C32H54O9/c1-7-8-18-32(4,5)19-11-12-24-14-17-28(40-23(3)34)26(24)16-15-25(39-22(2)33)21-27(35)30(31(36)37-6)41-29-13-9-10-20-38-29/h24-26,28-30H,7-21H2,1-6H3/t24-,25?,26+,28-,29?,30?/m0/s1 |
| InChIKey | SGMLRAKQQNFWKQ-IEODGRSUSA-N |
| XLogP | 6.09 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.78 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|