C11H12ClN3O3 — CID 54305473
2-[[amino-(4-methoxyphenyl)methylidene]carbamoylamino]acetyl chloride (PubChem CID 54305473) has the molecular formula C11H12ClN3O3 and a molecular weight of 269.69 g/mol. Its IUPAC name is 2-[[amino-(4-methoxyphenyl)methylidene]carbamoylamino]acetyl chloride.
| Compound Name | 2-[[amino-(4-methoxyphenyl)methylidene]carbamoylamino]acetyl chloride |
|---|---|
| PubChem CID | 54305473 |
| Molecular Formula | C11H12ClN3O3 |
| Molecular Weight | 269.69 g/mol |
| Exact Mass | 269.06 |
| IUPAC Name | 2-[[amino-(4-methoxyphenyl)methylidene]carbamoylamino]acetyl chloride |
| SMILES | COc1ccc(C(N)=NC(=O)NCC(=O)Cl)cc1 |
| InChI | InChI=1S/C11H12ClN3O3/c1-18-8-4-2-7(3-5-8)10(13)15-11(17)14-6-9(12)16/h2-5H,6H2,1H3,(H3,13,14,15,17) |
| InChIKey | SHEJIEDRWFKIMC-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 93.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.69 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|