C16H14Br2N2O2 — CID 5430582
N-[(Z)-(3,5-dibromo-4-methoxyphenyl)methylideneamino]-4-methylbenzamide (PubChem CID 5430582) has the molecular formula C16H14Br2N2O2 and a molecular weight of 426.11 g/mol. Its IUPAC name is N-[(Z)-(3,5-dibromo-4-methoxyphenyl)methylideneamino]-4-methylbenzamide.
| Compound Name | N-[(Z)-(3,5-dibromo-4-methoxyphenyl)methylideneamino]-4-methylbenzamide |
|---|---|
| PubChem CID | 5430582 |
| Molecular Formula | C16H14Br2N2O2 |
| Molecular Weight | 426.11 g/mol |
| Exact Mass | 423.94 |
| IUPAC Name | N-[(Z)-(3,5-dibromo-4-methoxyphenyl)methylideneamino]-4-methylbenzamide |
| SMILES | COc1c(Br)cc(/C=N\NC(=O)c2ccc(C)cc2)cc1Br |
| InChI | InChI=1S/C16H14Br2N2O2/c1-10-3-5-12(6-4-10)16(21)20-19-9-11-7-13(17)15(22-2)14(18)8-11/h3-9H,1-2H3,(H,20,21)/b19-9- |
| InChIKey | QZIDGGGIAHEBOU-OCKHKDLRSA-N |
| XLogP | 4.29 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.11 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|