C23H35NO — CID 54306333
(1S,4aR,4bS)-1,4a-dimethyl-7-propan-2-yl-N-prop-2-enyl-2,3,4,4b,5,6,10,10a-octahydrophenanthrene-1-carboxamide (PubChem CID 54306333) has the molecular formula C23H35NO and a molecular weight of 341.54 g/mol. Its IUPAC name is (1S,4aR,4bS)-1,4a-dimethyl-7-propan-2-yl-N-prop-2-enyl-2,3,4,4b,5,6,10,10a-octahydrophenanthrene-1-carboxamide.
| Compound Name | (1S,4aR,4bS)-1,4a-dimethyl-7-propan-2-yl-N-prop-2-enyl-2,3,4,4b,5,6,10,10a-octahydrophenanthrene-1-carboxamide |
|---|---|
| PubChem CID | 54306333 |
| Molecular Formula | C23H35NO |
| Molecular Weight | 341.54 g/mol |
| Exact Mass | 341.27 |
| IUPAC Name | (1S,4aR,4bS)-1,4a-dimethyl-7-propan-2-yl-N-prop-2-enyl-2,3,4,4b,5,6,10,10a-octahydrophenanthrene-1-carboxamide |
| SMILES | C=CCNC(=O)[C@@]1(C)CCC[C@@]2(C)C1CC=C1C=C(C(C)C)CC[C@H]12 |
| InChI | InChI=1S/C23H35NO/c1-6-14-24-21(25)23(5)13-7-12-22(4)19-10-8-17(16(2)3)15-18(19)9-11-20(22)23/h6,9,15-16,19-20H,1,7-8,10-14H2,2-5H3,(H,24,25)/t19-,20?,22-,23+/m1/s1 |
| InChIKey | SHUABQHUPBAHSU-IWTWPRECSA-N |
| XLogP | 5.42 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.54 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|