C17H19F3O8S — CID 54307319
methyl 5-[2-(3-methoxy-3-oxoprop-1-enyl)-3-(trifluoromethylsulfonyloxy)phenoxy]pentanoate (PubChem CID 54307319) has the molecular formula C17H19F3O8S and a molecular weight of 440.39 g/mol. Its IUPAC name is methyl 5-[2-(3-methoxy-3-oxoprop-1-enyl)-3-(trifluoromethylsulfonyloxy)phenoxy]pentanoate.
| Compound Name | methyl 5-[2-(3-methoxy-3-oxoprop-1-enyl)-3-(trifluoromethylsulfonyloxy)phenoxy]pentanoate |
|---|---|
| PubChem CID | 54307319 |
| Molecular Formula | C17H19F3O8S |
| Molecular Weight | 440.39 g/mol |
| Exact Mass | 440.08 |
| IUPAC Name | methyl 5-[2-(3-methoxy-3-oxoprop-1-enyl)-3-(trifluoromethylsulfonyloxy)phenoxy]pentanoate |
| SMILES | COC(=O)C=Cc1c(OCCCCC(=O)OC)cccc1OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C17H19F3O8S/c1-25-15(21)8-3-4-11-27-13-6-5-7-14(12(13)9-10-16(22)26-2)28-29(23,24)17(18,19)20/h5-7,9-10H,3-4,8,11H2,1-2H3 |
| InChIKey | SIKWCKXNLCPIKO-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.39 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|