C25H34O6 — CID 67780421
methyl 8-[3-(6-hydroxyhex-1-ynyl)-2-[(E)-3-methoxy-3-oxoprop-1-enyl]phenoxy]octanoate (PubChem CID 67780421) has the molecular formula C25H34O6 and a molecular weight of 430.54 g/mol. Its IUPAC name is methyl 8-[3-(6-hydroxyhex-1-ynyl)-2-[(E)-3-methoxy-3-oxoprop-1-enyl]phenoxy]octanoate.
| Compound Name | methyl 8-[3-(6-hydroxyhex-1-ynyl)-2-[(E)-3-methoxy-3-oxoprop-1-enyl]phenoxy]octanoate |
|---|---|
| PubChem CID | 67780421 |
| Molecular Formula | C25H34O6 |
| Molecular Weight | 430.54 g/mol |
| Exact Mass | 430.24 |
| IUPAC Name | methyl 8-[3-(6-hydroxyhex-1-ynyl)-2-[(E)-3-methoxy-3-oxoprop-1-enyl]phenoxy]octanoate |
| SMILES | COC(=O)/C=C/c1c(C#CCCCCO)cccc1OCCCCCCCC(=O)OC |
| InChI | InChI=1S/C25H34O6/c1-29-24(27)16-9-4-3-7-11-20-31-23-15-12-14-21(13-8-5-6-10-19-26)22(23)17-18-25(28)30-2/h12,14-15,17-18,26H,3-7,9-11,16,19-20H2,1-2H3/b18-17+ |
| InChIKey | YCJFZNLQIQHEBV-ISLYRVAYSA-N |
| XLogP | 4.28 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.54 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|