C25H34O6 — CID 19922120
9-[3-(6-hydroxyhex-1-ynyl)-2-[(E)-3-methoxy-3-oxoprop-1-enyl]phenoxy]nonanoic acid (PubChem CID 19922120) has the molecular formula C25H34O6 and a molecular weight of 430.54 g/mol. Its IUPAC name is 9-[3-(6-hydroxyhex-1-ynyl)-2-[(E)-3-methoxy-3-oxoprop-1-enyl]phenoxy]nonanoic acid.
| Compound Name | 9-[3-(6-hydroxyhex-1-ynyl)-2-[(E)-3-methoxy-3-oxoprop-1-enyl]phenoxy]nonanoic acid |
|---|---|
| PubChem CID | 19922120 |
| Molecular Formula | C25H34O6 |
| Molecular Weight | 430.54 g/mol |
| Exact Mass | 430.24 |
| IUPAC Name | 9-[3-(6-hydroxyhex-1-ynyl)-2-[(E)-3-methoxy-3-oxoprop-1-enyl]phenoxy]nonanoic acid |
| SMILES | COC(=O)/C=C/c1c(C#CCCCCO)cccc1OCCCCCCCCC(=O)O |
| InChI | InChI=1S/C25H34O6/c1-30-25(29)18-17-22-21(13-8-5-6-10-19-26)14-12-15-23(22)31-20-11-7-3-2-4-9-16-24(27)28/h12,14-15,17-18,26H,2-7,9-11,16,19-20H2,1H3,(H,27,28)/b18-17+ |
| InChIKey | UUTZRPAOPAHMTK-ISLYRVAYSA-N |
| XLogP | 4.58 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.54 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|