C10H22 — CID 54308339
ethane;1,2,3,4-tetramethylcyclobutane (PubChem CID 54308339) has the molecular formula C10H22 and a molecular weight of 142.29 g/mol. Its IUPAC name is ethane;1,2,3,4-tetramethylcyclobutane.
| Compound Name | ethane;1,2,3,4-tetramethylcyclobutane |
|---|---|
| PubChem CID | 54308339 |
| Molecular Formula | C10H22 |
| Molecular Weight | 142.29 g/mol |
| Exact Mass | 142.17 |
| IUPAC Name | ethane;1,2,3,4-tetramethylcyclobutane |
| SMILES | CC.CC1C(C)C(C)C1C |
| InChI | InChI=1S/C8H16.C2H6/c1-5-6(2)8(4)7(5)3;1-2/h5-8H,1-4H3;1-2H3 |
| InChIKey | SJCRWGFDRDPNTL-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.29 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |