C19H13F6NO4 — CID 54311787
1,1,1,3,3,3-hexafluoropropan-2-yl 2,3-dimethoxyacridine-9-carboxylate (PubChem CID 54311787) has the molecular formula C19H13F6NO4 and a molecular weight of 433.30 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoropropan-2-yl 2,3-dimethoxyacridine-9-carboxylate.
| Compound Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 2,3-dimethoxyacridine-9-carboxylate |
|---|---|
| PubChem CID | 54311787 |
| Molecular Formula | C19H13F6NO4 |
| Molecular Weight | 433.30 g/mol |
| Exact Mass | 433.07 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 2,3-dimethoxyacridine-9-carboxylate |
| SMILES | COc1cc2nc3ccccc3c(C(=O)OC(C(F)(F)F)C(F)(F)F)c2cc1OC |
| InChI | InChI=1S/C19H13F6NO4/c1-28-13-7-10-12(8-14(13)29-2)26-11-6-4-3-5-9(11)15(10)16(27)30-17(18(20,21)22)19(23,24)25/h3-8,17H,1-2H3 |
| InChIKey | SLKJGDZSEQQMGA-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.30 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|