C8H19N2O6S2+ — CID 54312940
1-[1-(1-sulfoethyl)piperazin-1-ium-1-yl]ethanesulfonic acid (PubChem CID 54312940) has the molecular formula C8H19N2O6S2+ and a molecular weight of 303.38 g/mol. Its IUPAC name is 1-[1-(1-sulfoethyl)piperazin-1-ium-1-yl]ethanesulfonic acid.
| Compound Name | 1-[1-(1-sulfoethyl)piperazin-1-ium-1-yl]ethanesulfonic acid |
|---|---|
| PubChem CID | 54312940 |
| Molecular Formula | C8H19N2O6S2+ |
| Molecular Weight | 303.38 g/mol |
| Exact Mass | 303.07 |
| IUPAC Name | 1-[1-(1-sulfoethyl)piperazin-1-ium-1-yl]ethanesulfonic acid |
| SMILES | CC([N+]1(C(C)S(=O)(=O)O)CCNCC1)S(=O)(=O)O |
| InChI | InChI=1S/C8H18N2O6S2/c1-7(17(11,12)13)10(5-3-9-4-6-10)8(2)18(14,15)16/h7-9H,3-6H2,1-2H3,(H-,11,12,13,14,15,16)/p+1 |
| InChIKey | YFLHXCXVNDWYII-UHFFFAOYSA-O |
| XLogP | -1.13 |
| TPSA | 120.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.38 |
| LogP ≤ 5 | -1.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|