About 4-ethoxy-3,4-dihydro-2H-pyrrole-2-carbonitrile
4-ethoxy-3,4-dihydro-2H-pyrrole-2-carbonitrile (PubChem CID 543167) has the molecular formula C7H10N2O
and a molecular weight of 138.17 g/mol. Its IUPAC name is 4-ethoxy-3,4-dihydro-2H-pyrrole-2-carbonitrile.
Analyze 4-ethoxy-3,4-dihydro-2H-pyrrole-2-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethoxy-3,4-dihydro-2H-pyrrole-2-carbonitrile?
The IUPAC name of 4-ethoxy-3,4-dihydro-2H-pyrrole-2-carbonitrile (CID 543167) is 4-ethoxy-3,4-dihydro-2H-pyrrole-2-carbonitrile.
What is the SMILES notation for 4-ethoxy-3,4-dihydro-2H-pyrrole-2-carbonitrile?
The canonical SMILES for 4-ethoxy-3,4-dihydro-2H-pyrrole-2-carbonitrile is CCOC1C=NC(C#N)C1.
What is the InChIKey of 4-ethoxy-3,4-dihydro-2H-pyrrole-2-carbonitrile?
The InChIKey is LBMJHHYEQNRQLP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2O/c1-2-10-7-3-6(4-8)9-5-7/h5-7H,2-3H2,1H3.
What are the key properties of 4-ethoxy-3,4-dihydro-2H-pyrrole-2-carbonitrile?
4-ethoxy-3,4-dihydro-2H-pyrrole-2-carbonitrile has a molecular weight of 138.17 g/mol, XLogP of 0.76, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethoxy-3,4-dihydro-2H-pyrrole-2-carbonitrile is sourced from PubChem (CID 543167), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).