C10H8ClN3O3 — CID 54316935
ethyl 2-chloro-5-oxo-8H-pyrido[2,3-d]pyrimidine-6-carboxylate (PubChem CID 54316935) has the molecular formula C10H8ClN3O3 and a molecular weight of 253.64 g/mol. Its IUPAC name is ethyl 2-chloro-5-oxo-8H-pyrido[2,3-d]pyrimidine-6-carboxylate.
| Compound Name | ethyl 2-chloro-5-oxo-8H-pyrido[2,3-d]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 54316935 |
| Molecular Formula | C10H8ClN3O3 |
| Molecular Weight | 253.64 g/mol |
| Exact Mass | 253.03 |
| IUPAC Name | ethyl 2-chloro-5-oxo-8H-pyrido[2,3-d]pyrimidine-6-carboxylate |
| SMILES | CCOC(=O)c1c[nH]c2nc(Cl)ncc2c1=O |
| InChI | InChI=1S/C10H8ClN3O3/c1-2-17-9(16)6-4-12-8-5(7(6)15)3-13-10(11)14-8/h3-4H,2H2,1H3,(H,12,13,14,15) |
| InChIKey | SOWKKFOWDHDXKW-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.64 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |