C8H7N3O3S — CID 58332139
ethyl 7-oxo-4H-thiadiazolo[4,5-b]pyridine-6-carboxylate (PubChem CID 58332139) has the molecular formula C8H7N3O3S and a molecular weight of 225.23 g/mol. Its IUPAC name is ethyl 7-oxo-4H-thiadiazolo[4,5-b]pyridine-6-carboxylate.
| Compound Name | ethyl 7-oxo-4H-thiadiazolo[4,5-b]pyridine-6-carboxylate |
|---|---|
| PubChem CID | 58332139 |
| Molecular Formula | C8H7N3O3S |
| Molecular Weight | 225.23 g/mol |
| Exact Mass | 225.02 |
| IUPAC Name | ethyl 7-oxo-4H-thiadiazolo[4,5-b]pyridine-6-carboxylate |
| SMILES | CCOC(=O)c1c[nH]c2nnsc2c1=O |
| InChI | InChI=1S/C8H7N3O3S/c1-2-14-8(13)4-3-9-7-6(5(4)12)15-11-10-7/h3H,2H2,1H3,(H,9,12) |
| InChIKey | CTTAWEFEGGTJKH-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.23 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |