C13H14N2O4 — CID 19374333
ethyl 6-ethoxy-4-oxo-1H-1,8-naphthyridine-3-carboxylate (PubChem CID 19374333) has the molecular formula C13H14N2O4 and a molecular weight of 262.26 g/mol. Its IUPAC name is ethyl 6-ethoxy-4-oxo-1H-1,8-naphthyridine-3-carboxylate.
| Compound Name | ethyl 6-ethoxy-4-oxo-1H-1,8-naphthyridine-3-carboxylate |
|---|---|
| PubChem CID | 19374333 |
| Molecular Formula | C13H14N2O4 |
| Molecular Weight | 262.26 g/mol |
| Exact Mass | 262.10 |
| IUPAC Name | ethyl 6-ethoxy-4-oxo-1H-1,8-naphthyridine-3-carboxylate |
| SMILES | CCOC(=O)c1c[nH]c2ncc(OCC)cc2c1=O |
| InChI | InChI=1S/C13H14N2O4/c1-3-18-8-5-9-11(16)10(13(17)19-4-2)7-15-12(9)14-6-8/h5-7H,3-4H2,1-2H3,(H,14,15,16) |
| InChIKey | UCFWEHSOTZKMIE-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 81.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.26 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |