C17H13F2N3O3 — CID 68669544
3-(5-ethoxy-1H-pyrrolo[2,3-b]pyridine-3-carbonyl)-2,4-difluorobenzamide (PubChem CID 68669544) has the molecular formula C17H13F2N3O3 and a molecular weight of 345.31 g/mol. Its IUPAC name is 3-(5-ethoxy-1H-pyrrolo[2,3-b]pyridine-3-carbonyl)-2,4-difluorobenzamide.
| Compound Name | 3-(5-ethoxy-1H-pyrrolo[2,3-b]pyridine-3-carbonyl)-2,4-difluorobenzamide |
|---|---|
| PubChem CID | 68669544 |
| Molecular Formula | C17H13F2N3O3 |
| Molecular Weight | 345.31 g/mol |
| Exact Mass | 345.09 |
| IUPAC Name | 3-(5-ethoxy-1H-pyrrolo[2,3-b]pyridine-3-carbonyl)-2,4-difluorobenzamide |
| SMILES | CCOc1cnc2[nH]cc(C(=O)c3c(F)ccc(C(N)=O)c3F)c2c1 |
| InChI | InChI=1S/C17H13F2N3O3/c1-2-25-8-5-10-11(7-22-17(10)21-6-8)15(23)13-12(18)4-3-9(14(13)19)16(20)24/h3-7H,2H2,1H3,(H2,20,24)(H,21,22) |
| InChIKey | YEGPYDROARHJGM-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 98.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.31 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |