C19H25NO3 — CID 54317549
ethyl 6-cyano-6-(2,4-dimethylphenyl)-3,3-dimethyl-2-oxohexanoate (PubChem CID 54317549) has the molecular formula C19H25NO3 and a molecular weight of 315.41 g/mol. Its IUPAC name is ethyl 6-cyano-6-(2,4-dimethylphenyl)-3,3-dimethyl-2-oxohexanoate.
| Compound Name | ethyl 6-cyano-6-(2,4-dimethylphenyl)-3,3-dimethyl-2-oxohexanoate |
|---|---|
| PubChem CID | 54317549 |
| Molecular Formula | C19H25NO3 |
| Molecular Weight | 315.41 g/mol |
| Exact Mass | 315.18 |
| IUPAC Name | ethyl 6-cyano-6-(2,4-dimethylphenyl)-3,3-dimethyl-2-oxohexanoate |
| SMILES | CCOC(=O)C(=O)C(C)(C)CCC(C#N)c1ccc(C)cc1C |
| InChI | InChI=1S/C19H25NO3/c1-6-23-18(22)17(21)19(4,5)10-9-15(12-20)16-8-7-13(2)11-14(16)3/h7-8,11,15H,6,9-10H2,1-5H3 |
| InChIKey | SPHLWKOOMRYANT-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 67.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.41 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|