C10H8N6O6 — CID 54320083
1-(1-isocyanatoethyl)-3,5-bis(isocyanatomethyl)-1,3,5-triazinane-2,4,6-trione (PubChem CID 54320083) has the molecular formula C10H8N6O6 and a molecular weight of 308.21 g/mol. Its IUPAC name is 1-(1-isocyanatoethyl)-3,5-bis(isocyanatomethyl)-1,3,5-triazinane-2,4,6-trione.
| Compound Name | 1-(1-isocyanatoethyl)-3,5-bis(isocyanatomethyl)-1,3,5-triazinane-2,4,6-trione |
|---|---|
| PubChem CID | 54320083 |
| Molecular Formula | C10H8N6O6 |
| Molecular Weight | 308.21 g/mol |
| Exact Mass | 308.05 |
| IUPAC Name | 1-(1-isocyanatoethyl)-3,5-bis(isocyanatomethyl)-1,3,5-triazinane-2,4,6-trione |
| SMILES | CC(N=C=O)n1c(=O)n(CN=C=O)c(=O)n(CN=C=O)c1=O |
| InChI | InChI=1S/C10H8N6O6/c1-7(13-6-19)16-9(21)14(2-11-4-17)8(20)15(10(16)22)3-12-5-18/h7H,2-3H2,1H3 |
| InChIKey | SRAFUUOXTNSRQN-UHFFFAOYSA-N |
| XLogP | -2.39 |
| TPSA | 154.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.21 |
| LogP ≤ 5 | -2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|