C10H19N3O2 — CID 23541484
1,3,5-triethyl-6-methyl-1,3,5-triazinane-2,4-dione (PubChem CID 23541484) has the molecular formula C10H19N3O2 and a molecular weight of 213.28 g/mol. Its IUPAC name is 1,3,5-triethyl-6-methyl-1,3,5-triazinane-2,4-dione.
| Compound Name | 1,3,5-triethyl-6-methyl-1,3,5-triazinane-2,4-dione |
|---|---|
| PubChem CID | 23541484 |
| Molecular Formula | C10H19N3O2 |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.15 |
| IUPAC Name | 1,3,5-triethyl-6-methyl-1,3,5-triazinane-2,4-dione |
| SMILES | CCN1C(=O)N(CC)C(C)N(CC)C1=O |
| InChI | InChI=1S/C10H19N3O2/c1-5-11-8(4)12(6-2)10(15)13(7-3)9(11)14/h8H,5-7H2,1-4H3 |
| InChIKey | WDXCGSYHCJUZNF-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |