C15H25N5O5 — CID 54308965
1,3-diethyl-1,3-diazetidine-2,4-dione;1,3,5-triethyl-1,3,5-triazinane-2,4,6-trione (PubChem CID 54308965) has the molecular formula C15H25N5O5 and a molecular weight of 355.40 g/mol. Its IUPAC name is 1,3-diethyl-1,3-diazetidine-2,4-dione;1,3,5-triethyl-1,3,5-triazinane-2,4,6-trione.
| Compound Name | 1,3-diethyl-1,3-diazetidine-2,4-dione;1,3,5-triethyl-1,3,5-triazinane-2,4,6-trione |
|---|---|
| PubChem CID | 54308965 |
| Molecular Formula | C15H25N5O5 |
| Molecular Weight | 355.40 g/mol |
| Exact Mass | 355.19 |
| IUPAC Name | 1,3-diethyl-1,3-diazetidine-2,4-dione;1,3,5-triethyl-1,3,5-triazinane-2,4,6-trione |
| SMILES | CCN1C(=O)N(CC)C1=O.CCn1c(=O)n(CC)c(=O)n(CC)c1=O |
| InChI | InChI=1S/C9H15N3O3.C6H10N2O2/c1-4-10-7(13)11(5-2)9(15)12(6-3)8(10)14;1-3-7-5(9)8(4-2)6(7)10/h4-6H2,1-3H3;3-4H2,1-2H3 |
| InChIKey | SJNSMKOZJBXEOR-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 106.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.40 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |