C13H25N5O5 — CID 159494877
1-ethyl-3,5-bis(isocyanatomethyl)-1,3,5-triazinane-2,4,6-trione;methane (PubChem CID 159494877) has the molecular formula C13H25N5O5 and a molecular weight of 331.37 g/mol. Its IUPAC name is 1-ethyl-3,5-bis(isocyanatomethyl)-1,3,5-triazinane-2,4,6-trione;methane.
| Compound Name | 1-ethyl-3,5-bis(isocyanatomethyl)-1,3,5-triazinane-2,4,6-trione;methane |
|---|---|
| PubChem CID | 159494877 |
| Molecular Formula | C13H25N5O5 |
| Molecular Weight | 331.37 g/mol |
| Exact Mass | 331.19 |
| IUPAC Name | 1-ethyl-3,5-bis(isocyanatomethyl)-1,3,5-triazinane-2,4,6-trione;methane |
| SMILES | C.C.C.C.CCn1c(=O)n(CN=C=O)c(=O)n(CN=C=O)c1=O |
| InChI | InChI=1S/C9H9N5O5.4CH4/c1-2-12-7(17)13(3-10-5-15)9(19)14(8(12)18)4-11-6-16;;;;/h2-4H2,1H3;4*1H4 |
| InChIKey | LYQRVVAMBUKAIO-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 124.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.37 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|