C21H33N3O7 — CID 54320864
(2,5-dihydroxypyrrol-1-yl) (2S)-2-(cyclopentanecarbonylamino)-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate (PubChem CID 54320864) has the molecular formula C21H33N3O7 and a molecular weight of 439.51 g/mol. Its IUPAC name is (2,5-dihydroxypyrrol-1-yl) (2S)-2-(cyclopentanecarbonylamino)-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate.
| Compound Name | (2,5-dihydroxypyrrol-1-yl) (2S)-2-(cyclopentanecarbonylamino)-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate |
|---|---|
| PubChem CID | 54320864 |
| Molecular Formula | C21H33N3O7 |
| Molecular Weight | 439.51 g/mol |
| Exact Mass | 439.23 |
| IUPAC Name | (2,5-dihydroxypyrrol-1-yl) (2S)-2-(cyclopentanecarbonylamino)-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate |
| SMILES | CC(C)(C)OC(=O)NCCCC[C@H](NC(=O)C1CCCC1)C(=O)On1c(O)ccc1O |
| InChI | InChI=1S/C21H33N3O7/c1-21(2,3)30-20(29)22-13-7-6-10-15(23-18(27)14-8-4-5-9-14)19(28)31-24-16(25)11-12-17(24)26/h11-12,14-15,25-26H,4-10,13H2,1-3H3,(H,22,29)(H,23,27)/t15-/m0/s1 |
| InChIKey | SROIGRSVKTXWBR-HNNXBMFYSA-N |
| XLogP | 2.22 |
| TPSA | 139.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.51 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|