C30H23N4OS+ — CID 54322246
2-[2-[2-(furan-2-yl)-4-(1H-pyrrol-2-yl)thiophen-3-yl]-1-methylpyrrol-1-ium-1-yl]-5-naphthalen-2-yl-1H-imidazole (PubChem CID 54322246) has the molecular formula C30H23N4OS+ and a molecular weight of 487.61 g/mol. Its IUPAC name is 2-[2-[2-(furan-2-yl)-4-(1H-pyrrol-2-yl)thiophen-3-yl]-1-methylpyrrol-1-ium-1-yl]-5-naphthalen-2-yl-1H-imidazole.
| Compound Name | 2-[2-[2-(furan-2-yl)-4-(1H-pyrrol-2-yl)thiophen-3-yl]-1-methylpyrrol-1-ium-1-yl]-5-naphthalen-2-yl-1H-imidazole |
|---|---|
| PubChem CID | 54322246 |
| Molecular Formula | C30H23N4OS+ |
| Molecular Weight | 487.61 g/mol |
| Exact Mass | 487.16 |
| IUPAC Name | 2-[2-[2-(furan-2-yl)-4-(1H-pyrrol-2-yl)thiophen-3-yl]-1-methylpyrrol-1-ium-1-yl]-5-naphthalen-2-yl-1H-imidazole |
| SMILES | C[N+]1(c2ncc(-c3ccc4ccccc4c3)[nH]2)C=CC=C1c1c(-c2ccc[nH]2)csc1-c1ccco1 |
| InChI | InChI=1S/C30H23N4OS/c1-34(30-32-18-25(33-30)22-13-12-20-7-2-3-8-21(20)17-22)15-5-10-26(34)28-23(24-9-4-14-31-24)19-36-29(28)27-11-6-16-35-27/h2-19,31H,1H3,(H,32,33)/q+1 |
| InChIKey | AGTYRATULVGARA-UHFFFAOYSA-N |
| XLogP | 8.05 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.61 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|