About 2H-indeno[1,2-c]pyridine
2H-indeno[1,2-c]pyridine (PubChem CID 54326183) has the molecular formula C12H9N
and a molecular weight of 167.21 g/mol. Its IUPAC name is 2H-indeno[1,2-c]pyridine.
Molecular Properties
| Compound Name | 2H-indeno[1,2-c]pyridine |
| PubChem CID | 54326183 |
| Molecular Formula | C12H9N |
| Molecular Weight | 167.21 g/mol |
| Exact Mass | 167.07 |
| IUPAC Name | 2H-indeno[1,2-c]pyridine |
| SMILES | c1ccc2c3c[nH]ccc-3cc2c1 |
| InChI | InChI=1S/C12H9N/c1-2-4-11-9(3-1)7-10-5-6-13-8-12(10)11/h1-8,13H |
| InChIKey | SVCFFBMBIBMUQQ-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.21 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 2H-indeno[1,2-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2H-indeno[1,2-c]pyridine?
The IUPAC name of 2H-indeno[1,2-c]pyridine (CID 54326183) is 2H-indeno[1,2-c]pyridine.
What is the SMILES notation for 2H-indeno[1,2-c]pyridine?
The canonical SMILES for 2H-indeno[1,2-c]pyridine is c1ccc2c3c[nH]ccc-3cc2c1.
What is the InChIKey of 2H-indeno[1,2-c]pyridine?
The InChIKey is SVCFFBMBIBMUQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9N/c1-2-4-11-9(3-1)7-10-5-6-13-8-12(10)11/h1-8,13H.
What are the key properties of 2H-indeno[1,2-c]pyridine?
2H-indeno[1,2-c]pyridine has a molecular weight of 167.21 g/mol, XLogP of 3.27, 0 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2H-indeno[1,2-c]pyridine is sourced from PubChem (CID 54326183), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).