C13H20F2O — CID 54327007
6,6-difluoro-5-methyl-2-(4-methylcyclohexyl)-2,3-dihydropyran (PubChem CID 54327007) has the molecular formula C13H20F2O and a molecular weight of 230.30 g/mol. Its IUPAC name is 6,6-difluoro-5-methyl-2-(4-methylcyclohexyl)-2,3-dihydropyran.
| Compound Name | 6,6-difluoro-5-methyl-2-(4-methylcyclohexyl)-2,3-dihydropyran |
|---|---|
| PubChem CID | 54327007 |
| Molecular Formula | C13H20F2O |
| Molecular Weight | 230.30 g/mol |
| Exact Mass | 230.15 |
| IUPAC Name | 6,6-difluoro-5-methyl-2-(4-methylcyclohexyl)-2,3-dihydropyran |
| SMILES | CC1=CCC(C2CCC(C)CC2)OC1(F)F |
| InChI | InChI=1S/C13H20F2O/c1-9-3-6-11(7-4-9)12-8-5-10(2)13(14,15)16-12/h5,9,11-12H,3-4,6-8H2,1-2H3 |
| InChIKey | SVQRGJRFAPXGNL-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.30 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|