C19H24F2O — CID 54300501
6,6-difluoro-5-methyl-2-[4-(4-methylcyclohexyl)phenyl]-2,3-dihydropyran (PubChem CID 54300501) has the molecular formula C19H24F2O and a molecular weight of 306.40 g/mol. Its IUPAC name is 6,6-difluoro-5-methyl-2-[4-(4-methylcyclohexyl)phenyl]-2,3-dihydropyran.
| Compound Name | 6,6-difluoro-5-methyl-2-[4-(4-methylcyclohexyl)phenyl]-2,3-dihydropyran |
|---|---|
| PubChem CID | 54300501 |
| Molecular Formula | C19H24F2O |
| Molecular Weight | 306.40 g/mol |
| Exact Mass | 306.18 |
| IUPAC Name | 6,6-difluoro-5-methyl-2-[4-(4-methylcyclohexyl)phenyl]-2,3-dihydropyran |
| SMILES | CC1=CCC(c2ccc(C3CCC(C)CC3)cc2)OC1(F)F |
| InChI | InChI=1S/C19H24F2O/c1-13-3-6-15(7-4-13)16-8-10-17(11-9-16)18-12-5-14(2)19(20,21)22-18/h5,8-11,13,15,18H,3-4,6-7,12H2,1-2H3 |
| InChIKey | SDVSLASTTBZCNY-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.40 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|