C56H36N8S4 — CID 54330644
5,10,15,20-tetrakis(5-thiophen-3-yl-3-pyridinyl)-21,22,23,24-tetrahydroporphyrin (PubChem CID 54330644) has the molecular formula C56H36N8S4 and a molecular weight of 949.23 g/mol. Its IUPAC name is 5,10,15,20-tetrakis(5-thiophen-3-yl-3-pyridinyl)-21,22,23,24-tetrahydroporphyrin.
| Compound Name | 5,10,15,20-tetrakis(5-thiophen-3-yl-3-pyridinyl)-21,22,23,24-tetrahydroporphyrin |
|---|---|
| PubChem CID | 54330644 |
| Molecular Formula | C56H36N8S4 |
| Molecular Weight | 949.23 g/mol |
| Exact Mass | 948.19 |
| IUPAC Name | 5,10,15,20-tetrakis(5-thiophen-3-yl-3-pyridinyl)-21,22,23,24-tetrahydroporphyrin |
| SMILES | c1cc(-c2cncc(C3=c4ccc([nH]4)=C(c4cncc(-c5ccsc5)c4)c4ccc([nH]4)C(c4cncc(-c5ccsc5)c4)=c4ccc([nH]4)=C(c4cncc(-c5ccsc5)c4)c4ccc3[nH]4)c2)cs1 |
| InChI | InChI=1S/C56H36N8S4/c1-2-46-54(42-18-38(22-58-26-42)34-10-14-66-30-34)48-5-6-50(63-48)56(44-20-40(24-60-28-44)36-12-16-68-32-36)52-8-7-51(64-52)55(43-19-39(23-59-27-43)35-11-15-67-31-35)49-4-3-47(62-49)53(45(1)61-46)41-17-37(21-57-25-41)33-9-13-65-29-33/h1-32,61-64H |
| InChIKey | LHHCYWVJGHYEJR-UHFFFAOYSA-N |
| XLogP | 10.80 |
| TPSA | 114.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 949.23 |
| LogP ≤ 5 | 10.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |