C10H11BrIN3OS — CID 5433168
[(Z)-(5-bromo-2-ethoxy-3-iodophenyl)methylideneamino]thiourea (PubChem CID 5433168) has the molecular formula C10H11BrIN3OS and a molecular weight of 428.09 g/mol. Its IUPAC name is [(Z)-(5-bromo-2-ethoxy-3-iodophenyl)methylideneamino]thiourea.
| Compound Name | [(Z)-(5-bromo-2-ethoxy-3-iodophenyl)methylideneamino]thiourea |
|---|---|
| PubChem CID | 5433168 |
| Molecular Formula | C10H11BrIN3OS |
| Molecular Weight | 428.09 g/mol |
| Exact Mass | 426.89 |
| IUPAC Name | [(Z)-(5-bromo-2-ethoxy-3-iodophenyl)methylideneamino]thiourea |
| SMILES | CCOc1c(I)cc(Br)cc1/C=N\NC(N)=S |
| InChI | InChI=1S/C10H11BrIN3OS/c1-2-16-9-6(5-14-15-10(13)17)3-7(11)4-8(9)12/h3-5H,2H2,1H3,(H3,13,15,17)/b14-5- |
| InChIKey | SULRHGWARXSIQB-RZNTYIFUSA-N |
| XLogP | 2.62 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.09 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|