C25H37NO5 — CID 54332878
[(2S)-6-[(2S,3S)-3-hexyl-4-oxooxetan-2-yl]hexan-2-yl] (2S)-2-formamido-3-phenylpropanoate (PubChem CID 54332878) has the molecular formula C25H37NO5 and a molecular weight of 431.57 g/mol. Its IUPAC name is [(2S)-6-[(2S,3S)-3-hexyl-4-oxooxetan-2-yl]hexan-2-yl] (2S)-2-formamido-3-phenylpropanoate.
| Compound Name | [(2S)-6-[(2S,3S)-3-hexyl-4-oxooxetan-2-yl]hexan-2-yl] (2S)-2-formamido-3-phenylpropanoate |
|---|---|
| PubChem CID | 54332878 |
| Molecular Formula | C25H37NO5 |
| Molecular Weight | 431.57 g/mol |
| Exact Mass | 431.27 |
| IUPAC Name | [(2S)-6-[(2S,3S)-3-hexyl-4-oxooxetan-2-yl]hexan-2-yl] (2S)-2-formamido-3-phenylpropanoate |
| SMILES | CCCCCC[C@@H]1C(=O)O[C@H]1CCCC[C@H](C)OC(=O)[C@H](Cc1ccccc1)NC=O |
| InChI | InChI=1S/C25H37NO5/c1-3-4-5-9-15-21-23(31-24(21)28)16-11-10-12-19(2)30-25(29)22(26-18-27)17-20-13-7-6-8-14-20/h6-8,13-14,18-19,21-23H,3-5,9-12,15-17H2,1-2H3,(H,26,27)/t19-,21-,22-,23-/m0/s1 |
| InChIKey | SZOQBUCRLQOYAI-UDIDDNNKSA-N |
| XLogP | 4.35 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.57 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'four_member_lactones', 'substructure': 'N/A'} |
|---|