C20H39N3O2 — CID 54335628
2-[1-(cyclohexylmethyl)piperidin-2-yl]ethyl N-[3-(dimethylamino)propyl]carbamate (PubChem CID 54335628) has the molecular formula C20H39N3O2 and a molecular weight of 353.55 g/mol. Its IUPAC name is 2-[1-(cyclohexylmethyl)piperidin-2-yl]ethyl N-[3-(dimethylamino)propyl]carbamate.
| Compound Name | 2-[1-(cyclohexylmethyl)piperidin-2-yl]ethyl N-[3-(dimethylamino)propyl]carbamate |
|---|---|
| PubChem CID | 54335628 |
| Molecular Formula | C20H39N3O2 |
| Molecular Weight | 353.55 g/mol |
| Exact Mass | 353.30 |
| IUPAC Name | 2-[1-(cyclohexylmethyl)piperidin-2-yl]ethyl N-[3-(dimethylamino)propyl]carbamate |
| SMILES | CN(C)CCCNC(=O)OCCC1CCCCN1CC1CCCCC1 |
| InChI | InChI=1S/C20H39N3O2/c1-22(2)14-8-13-21-20(24)25-16-12-19-11-6-7-15-23(19)17-18-9-4-3-5-10-18/h18-19H,3-17H2,1-2H3,(H,21,24) |
| InChIKey | TVGWTJWWGYRPDJ-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.55 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|