C19H21NO5 — CID 54343261
methyl 4-[2-[5-hydroxy-6-(3-methoxy-3-oxopropyl)-2-pyridinyl]ethyl]benzoate (PubChem CID 54343261) has the molecular formula C19H21NO5 and a molecular weight of 343.38 g/mol. Its IUPAC name is methyl 4-[2-[5-hydroxy-6-(3-methoxy-3-oxopropyl)-2-pyridinyl]ethyl]benzoate.
| Compound Name | methyl 4-[2-[5-hydroxy-6-(3-methoxy-3-oxopropyl)-2-pyridinyl]ethyl]benzoate |
|---|---|
| PubChem CID | 54343261 |
| Molecular Formula | C19H21NO5 |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | methyl 4-[2-[5-hydroxy-6-(3-methoxy-3-oxopropyl)-2-pyridinyl]ethyl]benzoate |
| SMILES | COC(=O)CCc1nc(CCc2ccc(C(=O)OC)cc2)ccc1O |
| InChI | InChI=1S/C19H21NO5/c1-24-18(22)12-10-16-17(21)11-9-15(20-16)8-5-13-3-6-14(7-4-13)19(23)25-2/h3-4,6-7,9,11,21H,5,8,10,12H2,1-2H3 |
| InChIKey | UAMCOIYLVYKNFK-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 85.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |