C23H26BrN3O3 — CID 54347115
N-[1-amino-4-bromo-2-(1H-indol-3-ylmethyl)-3-oxobutyl]-N-[(2-methoxyphenyl)methyl]acetamide (PubChem CID 54347115) has the molecular formula C23H26BrN3O3 and a molecular weight of 472.38 g/mol. Its IUPAC name is N-[1-amino-4-bromo-2-(1H-indol-3-ylmethyl)-3-oxobutyl]-N-[(2-methoxyphenyl)methyl]acetamide.
| Compound Name | N-[1-amino-4-bromo-2-(1H-indol-3-ylmethyl)-3-oxobutyl]-N-[(2-methoxyphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 54347115 |
| Molecular Formula | C23H26BrN3O3 |
| Molecular Weight | 472.38 g/mol |
| Exact Mass | 471.12 |
| IUPAC Name | N-[1-amino-4-bromo-2-(1H-indol-3-ylmethyl)-3-oxobutyl]-N-[(2-methoxyphenyl)methyl]acetamide |
| SMILES | COc1ccccc1CN(C(C)=O)C(N)C(Cc1c[nH]c2ccccc12)C(=O)CBr |
| InChI | InChI=1S/C23H26BrN3O3/c1-15(28)27(14-16-7-3-6-10-22(16)30-2)23(25)19(21(29)12-24)11-17-13-26-20-9-5-4-8-18(17)20/h3-10,13,19,23,26H,11-12,14,25H2,1-2H3 |
| InChIKey | UDBOKISMYKVMDP-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 88.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.38 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|