C10H19NO3 — CID 54350790
4-carboxy-N,N-diethylpent-4-en-1-amine oxide (PubChem CID 54350790) has the molecular formula C10H19NO3 and a molecular weight of 201.27 g/mol. Its IUPAC name is 4-carboxy-N,N-diethylpent-4-en-1-amine oxide.
| Compound Name | 4-carboxy-N,N-diethylpent-4-en-1-amine oxide |
|---|---|
| PubChem CID | 54350790 |
| Molecular Formula | C10H19NO3 |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.14 |
| IUPAC Name | 4-carboxy-N,N-diethylpent-4-en-1-amine oxide |
| SMILES | C=C(CCC[N+]([O-])(CC)CC)C(=O)O |
| InChI | InChI=1S/C10H19NO3/c1-4-11(14,5-2)8-6-7-9(3)10(12)13/h3-8H2,1-2H3,(H,12,13) |
| InChIKey | UFPGDACWVNMHNR-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 60.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|