C18H15Cl2NO2 — CID 54352026
4-(2,4-dichlorophenyl)-N-(3,5-dimethylphenyl)-4-oxobut-2-enamide (PubChem CID 54352026) has the molecular formula C18H15Cl2NO2 and a molecular weight of 348.23 g/mol. Its IUPAC name is 4-(2,4-dichlorophenyl)-N-(3,5-dimethylphenyl)-4-oxobut-2-enamide.
| Compound Name | 4-(2,4-dichlorophenyl)-N-(3,5-dimethylphenyl)-4-oxobut-2-enamide |
|---|---|
| PubChem CID | 54352026 |
| Molecular Formula | C18H15Cl2NO2 |
| Molecular Weight | 348.23 g/mol |
| Exact Mass | 347.05 |
| IUPAC Name | 4-(2,4-dichlorophenyl)-N-(3,5-dimethylphenyl)-4-oxobut-2-enamide |
| SMILES | Cc1cc(C)cc(NC(=O)C=CC(=O)c2ccc(Cl)cc2Cl)c1 |
| InChI | InChI=1S/C18H15Cl2NO2/c1-11-7-12(2)9-14(8-11)21-18(23)6-5-17(22)15-4-3-13(19)10-16(15)20/h3-10H,1-2H3,(H,21,23) |
| InChIKey | UGLDKRBJMPSGJL-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.23 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|