About 2-cyanoethyl 5-(2-nitrophenyl)-3-oxopent-4-enoate
2-cyanoethyl 5-(2-nitrophenyl)-3-oxopent-4-enoate (PubChem CID 54352274) has the molecular formula C14H12N2O5
and a molecular weight of 288.26 g/mol. Its IUPAC name is 2-cyanoethyl 5-(2-nitrophenyl)-3-oxopent-4-enoate.
Molecular Properties
| Compound Name | 2-cyanoethyl 5-(2-nitrophenyl)-3-oxopent-4-enoate |
| PubChem CID | 54352274 |
| Molecular Formula | C14H12N2O5 |
| Molecular Weight | 288.26 g/mol |
| Exact Mass | 288.07 |
| IUPAC Name | 2-cyanoethyl 5-(2-nitrophenyl)-3-oxopent-4-enoate |
| SMILES | N#CCCOC(=O)CC(=O)C=Cc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H12N2O5/c15-8-3-9-21-14(18)10-12(17)7-6-11-4-1-2-5-13(11)16(19)20/h1-2,4-7H,3,9-10H2 |
| InChIKey | UGPHVBCAQVRQLB-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 110.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.26 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-cyanoethyl 5-(2-nitrophenyl)-3-oxopent-4-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyanoethyl 5-(2-nitrophenyl)-3-oxopent-4-enoate?
The IUPAC name of 2-cyanoethyl 5-(2-nitrophenyl)-3-oxopent-4-enoate (CID 54352274) is 2-cyanoethyl 5-(2-nitrophenyl)-3-oxopent-4-enoate.
What is the SMILES notation for 2-cyanoethyl 5-(2-nitrophenyl)-3-oxopent-4-enoate?
The canonical SMILES for 2-cyanoethyl 5-(2-nitrophenyl)-3-oxopent-4-enoate is N#CCCOC(=O)CC(=O)C=Cc1ccccc1[N+](=O)[O-].
What is the InChIKey of 2-cyanoethyl 5-(2-nitrophenyl)-3-oxopent-4-enoate?
The InChIKey is UGPHVBCAQVRQLB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12N2O5/c15-8-3-9-21-14(18)10-12(17)7-6-11-4-1-2-5-13(11)16(19)20/h1-2,4-7H,3,9-10H2.
What are the key properties of 2-cyanoethyl 5-(2-nitrophenyl)-3-oxopent-4-enoate?
2-cyanoethyl 5-(2-nitrophenyl)-3-oxopent-4-enoate has a molecular weight of 288.26 g/mol, XLogP of 2.02, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyanoethyl 5-(2-nitrophenyl)-3-oxopent-4-enoate is sourced from PubChem (CID 54352274), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).