C13H10BrN3O4S — CID 5435235
(2S)-2-(4-bromophenyl)-2-hydroxy-N-[(Z)-(5-nitrothiophen-2-yl)methylideneamino]acetamide (PubChem CID 5435235) has the molecular formula C13H10BrN3O4S and a molecular weight of 384.21 g/mol. Its IUPAC name is (2S)-2-(4-bromophenyl)-2-hydroxy-N-[(Z)-(5-nitrothiophen-2-yl)methylideneamino]acetamide.
| Compound Name | (2S)-2-(4-bromophenyl)-2-hydroxy-N-[(Z)-(5-nitrothiophen-2-yl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 5435235 |
| Molecular Formula | C13H10BrN3O4S |
| Molecular Weight | 384.21 g/mol |
| Exact Mass | 382.96 |
| IUPAC Name | (2S)-2-(4-bromophenyl)-2-hydroxy-N-[(Z)-(5-nitrothiophen-2-yl)methylideneamino]acetamide |
| SMILES | O=C(N/N=C\c1ccc([N+](=O)[O-])s1)[C@@H](O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C13H10BrN3O4S/c14-9-3-1-8(2-4-9)12(18)13(19)16-15-7-10-5-6-11(22-10)17(20)21/h1-7,12,18H,(H,16,19)/b15-7-/t12-/m0/s1 |
| InChIKey | USWWDQRWWSXAJE-CUTJPZLCSA-N |
| XLogP | 2.60 |
| TPSA | 104.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.21 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|