C6H5Cl2NO3S — CID 54352588
(2,3-dichlorophenyl) sulfamate (PubChem CID 54352588) has the molecular formula C6H5Cl2NO3S and a molecular weight of 242.08 g/mol. Its IUPAC name is (2,3-dichlorophenyl) sulfamate.
| Compound Name | (2,3-dichlorophenyl) sulfamate |
|---|---|
| PubChem CID | 54352588 |
| Molecular Formula | C6H5Cl2NO3S |
| Molecular Weight | 242.08 g/mol |
| Exact Mass | 240.94 |
| IUPAC Name | (2,3-dichlorophenyl) sulfamate |
| SMILES | NS(=O)(=O)Oc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C6H5Cl2NO3S/c7-4-2-1-3-5(6(4)8)12-13(9,10)11/h1-3H,(H2,9,10,11) |
| InChIKey | UGVBBWSSWMZDGC-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.08 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |