C46H68N2O4 — CID 54352782
tert-butyl 2-[4-[[2-butyl-4-(2-butylpentadec-6-enoyloxymethyl)-5-methylimidazol-1-yl]methyl]phenyl]benzoate (PubChem CID 54352782) has the molecular formula C46H68N2O4 and a molecular weight of 713.06 g/mol. Its IUPAC name is tert-butyl 2-[4-[[2-butyl-4-(2-butylpentadec-6-enoyloxymethyl)-5-methylimidazol-1-yl]methyl]phenyl]benzoate.
| Compound Name | tert-butyl 2-[4-[[2-butyl-4-(2-butylpentadec-6-enoyloxymethyl)-5-methylimidazol-1-yl]methyl]phenyl]benzoate |
|---|---|
| PubChem CID | 54352782 |
| Molecular Formula | C46H68N2O4 |
| Molecular Weight | 713.06 g/mol |
| Exact Mass | 712.52 |
| IUPAC Name | tert-butyl 2-[4-[[2-butyl-4-(2-butylpentadec-6-enoyloxymethyl)-5-methylimidazol-1-yl]methyl]phenyl]benzoate |
| SMILES | CCCCCCCCC=CCCCC(CCCC)C(=O)OCc1nc(CCCC)n(Cc2ccc(-c3ccccc3C(=O)OC(C)(C)C)cc2)c1C |
| InChI | InChI=1S/C46H68N2O4/c1-8-11-14-15-16-17-18-19-20-21-22-26-39(25-12-9-2)44(49)51-35-42-36(4)48(43(47-42)29-13-10-3)34-37-30-32-38(33-31-37)40-27-23-24-28-41(40)45(50)52-46(5,6)7/h19-20,23-24,27-28,30-33,39H,8-18,21-22,25-26,29,34-35H2,1-7H3 |
| InChIKey | UGYCSIHTWHPLST-UHFFFAOYSA-N |
| XLogP | 12.53 |
| TPSA | 70.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 713.06 |
| LogP ≤ 5 | 12.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|