C17H14N2O3 — CID 54352846
2-[(2S)-2-amino-3-(1H-indol-3-yl)propanoyl]cyclohexa-2,5-diene-1,4-dione (PubChem CID 54352846) has the molecular formula C17H14N2O3 and a molecular weight of 294.31 g/mol. Its IUPAC name is 2-[(2S)-2-amino-3-(1H-indol-3-yl)propanoyl]cyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2-[(2S)-2-amino-3-(1H-indol-3-yl)propanoyl]cyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 54352846 |
| Molecular Formula | C17H14N2O3 |
| Molecular Weight | 294.31 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | 2-[(2S)-2-amino-3-(1H-indol-3-yl)propanoyl]cyclohexa-2,5-diene-1,4-dione |
| SMILES | N[C@@H](Cc1c[nH]c2ccccc12)C(=O)C1=CC(=O)C=CC1=O |
| InChI | InChI=1S/C17H14N2O3/c18-14(17(22)13-8-11(20)5-6-16(13)21)7-10-9-19-15-4-2-1-3-12(10)15/h1-6,8-9,14,19H,7,18H2/t14-/m0/s1 |
| InChIKey | UGZICRYULNMXGP-AWEZNQCLSA-N |
| XLogP | 1.24 |
| TPSA | 93.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.31 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|