C27H29O9P — CID 54353454
hydroperoxy-[5-oxo-1,5-bis(phenylmethoxy)-2-phenylmethoxycarbonylpentyl]phosphinic acid (PubChem CID 54353454) has the molecular formula C27H29O9P and a molecular weight of 528.49 g/mol. Its IUPAC name is hydroperoxy-[5-oxo-1,5-bis(phenylmethoxy)-2-phenylmethoxycarbonylpentyl]phosphinic acid.
| Compound Name | hydroperoxy-[5-oxo-1,5-bis(phenylmethoxy)-2-phenylmethoxycarbonylpentyl]phosphinic acid |
|---|---|
| PubChem CID | 54353454 |
| Molecular Formula | C27H29O9P |
| Molecular Weight | 528.49 g/mol |
| Exact Mass | 528.15 |
| IUPAC Name | hydroperoxy-[5-oxo-1,5-bis(phenylmethoxy)-2-phenylmethoxycarbonylpentyl]phosphinic acid |
| SMILES | O=C(CCC(C(=O)OCc1ccccc1)C(OCc1ccccc1)P(=O)(O)OO)OCc1ccccc1 |
| InChI | InChI=1S/C27H29O9P/c28-25(33-18-21-10-4-1-5-11-21)17-16-24(26(29)34-19-22-12-6-2-7-13-22)27(37(31,32)36-30)35-20-23-14-8-3-9-15-23/h1-15,24,27,30H,16-20H2,(H,31,32) |
| InChIKey | UHKOULVQMAHERK-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 128.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.49 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|