C26H25Cl3N2O5S — CID 54357035
(3S,4R)-3-hydroxy-2,2-dimethyl-N-(2-phenylethyl)-4-[(2,3,4-trichlorophenyl)sulfonylamino]-3,4-dihydrochromene-6-carboxamide (PubChem CID 54357035) has the molecular formula C26H25Cl3N2O5S and a molecular weight of 583.92 g/mol. Its IUPAC name is (3S,4R)-3-hydroxy-2,2-dimethyl-N-(2-phenylethyl)-4-[(2,3,4-trichlorophenyl)sulfonylamino]-3,4-dihydrochromene-6-carboxamide.
| Compound Name | (3S,4R)-3-hydroxy-2,2-dimethyl-N-(2-phenylethyl)-4-[(2,3,4-trichlorophenyl)sulfonylamino]-3,4-dihydrochromene-6-carboxamide |
|---|---|
| PubChem CID | 54357035 |
| Molecular Formula | C26H25Cl3N2O5S |
| Molecular Weight | 583.92 g/mol |
| Exact Mass | 582.05 |
| IUPAC Name | (3S,4R)-3-hydroxy-2,2-dimethyl-N-(2-phenylethyl)-4-[(2,3,4-trichlorophenyl)sulfonylamino]-3,4-dihydrochromene-6-carboxamide |
| SMILES | CC1(C)Oc2ccc(C(=O)NCCc3ccccc3)cc2[C@@H](NS(=O)(=O)c2ccc(Cl)c(Cl)c2Cl)[C@@H]1O |
| InChI | InChI=1S/C26H25Cl3N2O5S/c1-26(2)24(32)23(31-37(34,35)20-11-9-18(27)21(28)22(20)29)17-14-16(8-10-19(17)36-26)25(33)30-13-12-15-6-4-3-5-7-15/h3-11,14,23-24,31-32H,12-13H2,1-2H3,(H,30,33)/t23-,24+/m1/s1 |
| InChIKey | UJUNNXNOVSPULC-RPWUZVMVSA-N |
| XLogP | 5.17 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.92 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|