C15H15N3S — CID 54359421
1-[(1R,2R)-2-phenylcyclopropyl]-3-pyridin-2-ylthiourea (PubChem CID 54359421) has the molecular formula C15H15N3S and a molecular weight of 269.37 g/mol. Its IUPAC name is 1-[(1R,2R)-2-phenylcyclopropyl]-3-pyridin-2-ylthiourea.
| Compound Name | 1-[(1R,2R)-2-phenylcyclopropyl]-3-pyridin-2-ylthiourea |
|---|---|
| PubChem CID | 54359421 |
| Molecular Formula | C15H15N3S |
| Molecular Weight | 269.37 g/mol |
| Exact Mass | 269.10 |
| IUPAC Name | 1-[(1R,2R)-2-phenylcyclopropyl]-3-pyridin-2-ylthiourea |
| SMILES | S=C(Nc1ccccn1)N[C@@H]1C[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C15H15N3S/c19-15(18-14-8-4-5-9-16-14)17-13-10-12(13)11-6-2-1-3-7-11/h1-9,12-13H,10H2,(H2,16,17,18,19)/t12-,13-/m1/s1 |
| InChIKey | ULLIWPYXSUORQD-CHWSQXEVSA-N |
| XLogP | 2.92 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.37 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|