C22H26O5 — CID 54362381
diethyl (2R)-2-[naphthalen-2-yl(prop-2-enoxy)methyl]butanedioate (PubChem CID 54362381) has the molecular formula C22H26O5 and a molecular weight of 370.45 g/mol. Its IUPAC name is diethyl (2R)-2-[naphthalen-2-yl(prop-2-enoxy)methyl]butanedioate.
| Compound Name | diethyl (2R)-2-[naphthalen-2-yl(prop-2-enoxy)methyl]butanedioate |
|---|---|
| PubChem CID | 54362381 |
| Molecular Formula | C22H26O5 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.18 |
| IUPAC Name | diethyl (2R)-2-[naphthalen-2-yl(prop-2-enoxy)methyl]butanedioate |
| SMILES | C=CCOC(c1ccc2ccccc2c1)[C@@H](CC(=O)OCC)C(=O)OCC |
| InChI | InChI=1S/C22H26O5/c1-4-13-27-21(18-12-11-16-9-7-8-10-17(16)14-18)19(22(24)26-6-3)15-20(23)25-5-2/h4,7-12,14,19,21H,1,5-6,13,15H2,2-3H3/t19-,21?/m1/s1 |
| InChIKey | UNKABJCMAYHVCY-YMBRHYMPSA-N |
| XLogP | 4.22 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|