C9H8ClN3S2 — CID 54367463
5-chloro-2-methyl-N-(1,3,4-thiadiazol-2-ylsulfanyl)aniline (PubChem CID 54367463) has the molecular formula C9H8ClN3S2 and a molecular weight of 257.77 g/mol. Its IUPAC name is 5-chloro-2-methyl-N-(1,3,4-thiadiazol-2-ylsulfanyl)aniline.
| Compound Name | 5-chloro-2-methyl-N-(1,3,4-thiadiazol-2-ylsulfanyl)aniline |
|---|---|
| PubChem CID | 54367463 |
| Molecular Formula | C9H8ClN3S2 |
| Molecular Weight | 257.77 g/mol |
| Exact Mass | 256.98 |
| IUPAC Name | 5-chloro-2-methyl-N-(1,3,4-thiadiazol-2-ylsulfanyl)aniline |
| SMILES | Cc1ccc(Cl)cc1NSc1nncs1 |
| InChI | InChI=1S/C9H8ClN3S2/c1-6-2-3-7(10)4-8(6)13-15-9-12-11-5-14-9/h2-5,13H,1H3 |
| InChIKey | UQTMBUQXZFLMOA-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.77 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|