About methyl 4-aminooxybutanoate
methyl 4-aminooxybutanoate (PubChem CID 54367972) has the molecular formula C5H11NO3
and a molecular weight of 133.15 g/mol. Its IUPAC name is methyl 4-aminooxybutanoate.
Molecular Properties
| Compound Name | methyl 4-aminooxybutanoate |
| PubChem CID | 54367972 |
| Molecular Formula | C5H11NO3 |
| Molecular Weight | 133.15 g/mol |
| Exact Mass | 133.07 |
| IUPAC Name | methyl 4-aminooxybutanoate |
| SMILES | COC(=O)CCCON |
| InChI | InChI=1S/C5H11NO3/c1-8-5(7)3-2-4-9-6/h2-4,6H2,1H3 |
| InChIKey | FUUBPYWVWFTFGV-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 133.15 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze methyl 4-aminooxybutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-aminooxybutanoate?
The IUPAC name of methyl 4-aminooxybutanoate (CID 54367972) is methyl 4-aminooxybutanoate.
What is the SMILES notation for methyl 4-aminooxybutanoate?
The canonical SMILES for methyl 4-aminooxybutanoate is COC(=O)CCCON.
What is the InChIKey of methyl 4-aminooxybutanoate?
The InChIKey is FUUBPYWVWFTFGV-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11NO3/c1-8-5(7)3-2-4-9-6/h2-4,6H2,1H3.
What are the key properties of methyl 4-aminooxybutanoate?
methyl 4-aminooxybutanoate has a molecular weight of 133.15 g/mol, XLogP of -0.17, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-aminooxybutanoate is sourced from PubChem (CID 54367972), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).