C14H22N2O2 — CID 54374083
methyl 8-imidazol-1-yl-4,4-dimethyloct-2-enoate (PubChem CID 54374083) has the molecular formula C14H22N2O2 and a molecular weight of 250.34 g/mol. Its IUPAC name is methyl 8-imidazol-1-yl-4,4-dimethyloct-2-enoate.
| Compound Name | methyl 8-imidazol-1-yl-4,4-dimethyloct-2-enoate |
|---|---|
| PubChem CID | 54374083 |
| Molecular Formula | C14H22N2O2 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.17 |
| IUPAC Name | methyl 8-imidazol-1-yl-4,4-dimethyloct-2-enoate |
| SMILES | COC(=O)C=CC(C)(C)CCCCn1ccnc1 |
| InChI | InChI=1S/C14H22N2O2/c1-14(2,8-6-13(17)18-3)7-4-5-10-16-11-9-15-12-16/h6,8-9,11-12H,4-5,7,10H2,1-3H3 |
| InChIKey | UVGCRUDETLMZOD-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|