About 2-methoxyethylbenzene;phenylmethanone
2-methoxyethylbenzene;phenylmethanone (PubChem CID 54375098) has the molecular formula C16H17O2+
and a molecular weight of 241.31 g/mol. Its IUPAC name is 2-methoxyethylbenzene;phenylmethanone.
Molecular Properties
| Compound Name | 2-methoxyethylbenzene;phenylmethanone |
| PubChem CID | 54375098 |
| Molecular Formula | C16H17O2+ |
| Molecular Weight | 241.31 g/mol |
| Exact Mass | 241.12 |
| IUPAC Name | 2-methoxyethylbenzene;phenylmethanone |
| SMILES | COCCc1ccccc1.O=[C+]c1ccccc1 |
| InChI | InChI=1S/C9H12O.C7H5O/c1-10-8-7-9-5-3-2-4-6-9;8-6-7-4-2-1-3-5-7/h2-6H,7-8H2,1H3;1-5H/q;+1 |
| InChIKey | UVXVKKLZWAYQKY-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.31 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 2-methoxyethylbenzene;phenylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxyethylbenzene;phenylmethanone?
The IUPAC name of 2-methoxyethylbenzene;phenylmethanone (CID 54375098) is 2-methoxyethylbenzene;phenylmethanone.
What is the SMILES notation for 2-methoxyethylbenzene;phenylmethanone?
The canonical SMILES for 2-methoxyethylbenzene;phenylmethanone is COCCc1ccccc1.O=[C+]c1ccccc1.
What is the InChIKey of 2-methoxyethylbenzene;phenylmethanone?
The InChIKey is UVXVKKLZWAYQKY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12O.C7H5O/c1-10-8-7-9-5-3-2-4-6-9;8-6-7-4-2-1-3-5-7/h2-6H,7-8H2,1H3;1-5H/q;+1.
What are the key properties of 2-methoxyethylbenzene;phenylmethanone?
2-methoxyethylbenzene;phenylmethanone has a molecular weight of 241.31 g/mol, XLogP of 3.02, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxyethylbenzene;phenylmethanone is sourced from PubChem (CID 54375098), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).