About N-(3-bromo-2-methylimidazo[1,2-a]pyridin-8-yl)-2-(2,6-dichlorophenyl)acetamide
N-(3-bromo-2-methylimidazo[1,2-a]pyridin-8-yl)-2-(2,6-dichlorophenyl)acetamide (PubChem CID 54375317) has the molecular formula C16H12BrCl2N3O
and a molecular weight of 413.10 g/mol. Its IUPAC name is N-(3-bromo-2-methylimidazo[1,2-a]pyridin-8-yl)-2-(2,6-dichlorophenyl)acetamide.
Molecular Properties
| Compound Name | N-(3-bromo-2-methylimidazo[1,2-a]pyridin-8-yl)-2-(2,6-dichlorophenyl)acetamide |
| PubChem CID | 54375317 |
| Molecular Formula | C16H12BrCl2N3O |
| Molecular Weight | 413.10 g/mol |
| Exact Mass | 410.95 |
| IUPAC Name | N-(3-bromo-2-methylimidazo[1,2-a]pyridin-8-yl)-2-(2,6-dichlorophenyl)acetamide |
| SMILES | Cc1nc2c(NC(=O)Cc3c(Cl)cccc3Cl)cccn2c1Br |
| InChI | InChI=1S/C16H12BrCl2N3O/c1-9-15(17)22-7-3-6-13(16(22)20-9)21-14(23)8-10-11(18)4-2-5-12(10)19/h2-7H,8H2,1H3,(H,21,23) |
| InChIKey | UWBRQBVJANTSIV-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 46.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 413.10 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(3-bromo-2-methylimidazo[1,2-a]pyridin-8-yl)-2-(2,6-dichlorophenyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-bromo-2-methylimidazo[1,2-a]pyridin-8-yl)-2-(2,6-dichlorophenyl)acetamide?
The IUPAC name of N-(3-bromo-2-methylimidazo[1,2-a]pyridin-8-yl)-2-(2,6-dichlorophenyl)acetamide (CID 54375317) is N-(3-bromo-2-methylimidazo[1,2-a]pyridin-8-yl)-2-(2,6-dichlorophenyl)acetamide.
What is the SMILES notation for N-(3-bromo-2-methylimidazo[1,2-a]pyridin-8-yl)-2-(2,6-dichlorophenyl)acetamide?
The canonical SMILES for N-(3-bromo-2-methylimidazo[1,2-a]pyridin-8-yl)-2-(2,6-dichlorophenyl)acetamide is Cc1nc2c(NC(=O)Cc3c(Cl)cccc3Cl)cccn2c1Br.
What is the InChIKey of N-(3-bromo-2-methylimidazo[1,2-a]pyridin-8-yl)-2-(2,6-dichlorophenyl)acetamide?
The InChIKey is UWBRQBVJANTSIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12BrCl2N3O/c1-9-15(17)22-7-3-6-13(16(22)20-9)21-14(23)8-10-11(18)4-2-5-12(10)19/h2-7H,8H2,1H3,(H,21,23).
What are the key properties of N-(3-bromo-2-methylimidazo[1,2-a]pyridin-8-yl)-2-(2,6-dichlorophenyl)acetamide?
N-(3-bromo-2-methylimidazo[1,2-a]pyridin-8-yl)-2-(2,6-dichlorophenyl)acetamide has a molecular weight of 413.10 g/mol, XLogP of 4.89, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-bromo-2-methylimidazo[1,2-a]pyridin-8-yl)-2-(2,6-dichlorophenyl)acetamide is sourced from PubChem (CID 54375317), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).